C23H16F7NO3 — CID 175927364
2,2,7-trifluoro-4-[(4-methoxyphenyl)methyl]-6-(2,3,5,6-tetrafluoro-4-methoxyphenyl)-3H-1,4-benzoxazine (PubChem CID 175927364) has the molecular formula C23H16F7NO3 and a molecular weight of 487.37 g/mol. Its IUPAC name is 2,2,7-trifluoro-4-[(4-methoxyphenyl)methyl]-6-(2,3,5,6-tetrafluoro-4-methoxyphenyl)-3H-1,4-benzoxazine.
| Compound Name | 2,2,7-trifluoro-4-[(4-methoxyphenyl)methyl]-6-(2,3,5,6-tetrafluoro-4-methoxyphenyl)-3H-1,4-benzoxazine |
|---|---|
| PubChem CID | 175927364 |
| Molecular Formula | C23H16F7NO3 |
| Molecular Weight | 487.37 g/mol |
| Exact Mass | 487.10 |
| IUPAC Name | 2,2,7-trifluoro-4-[(4-methoxyphenyl)methyl]-6-(2,3,5,6-tetrafluoro-4-methoxyphenyl)-3H-1,4-benzoxazine |
| SMILES | COc1ccc(CN2CC(F)(F)Oc3cc(F)c(-c4c(F)c(F)c(OC)c(F)c4F)cc32)cc1 |
| InChI | InChI=1S/C23H16F7NO3/c1-32-12-5-3-11(4-6-12)9-31-10-23(29,30)34-16-8-14(24)13(7-15(16)31)17-18(25)20(27)22(33-2)21(28)19(17)26/h3-8H,9-10H2,1-2H3 |
| InChIKey | AOBOSVMINWRNGJ-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.37 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|