C22H12F7NO3 — CID 169031235
2,2,7-trifluoro-4-[(4-methoxyphenyl)methyl]-6-(2,3,4,5-tetrafluorophenyl)-1,4-benzoxazin-3-one (PubChem CID 169031235) has the molecular formula C22H12F7NO3 and a molecular weight of 471.33 g/mol. Its IUPAC name is 2,2,7-trifluoro-4-[(4-methoxyphenyl)methyl]-6-(2,3,4,5-tetrafluorophenyl)-1,4-benzoxazin-3-one.
| Compound Name | 2,2,7-trifluoro-4-[(4-methoxyphenyl)methyl]-6-(2,3,4,5-tetrafluorophenyl)-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 169031235 |
| Molecular Formula | C22H12F7NO3 |
| Molecular Weight | 471.33 g/mol |
| Exact Mass | 471.07 |
| IUPAC Name | 2,2,7-trifluoro-4-[(4-methoxyphenyl)methyl]-6-(2,3,4,5-tetrafluorophenyl)-1,4-benzoxazin-3-one |
| SMILES | COc1ccc(CN2C(=O)C(F)(F)Oc3cc(F)c(-c4cc(F)c(F)c(F)c4F)cc32)cc1 |
| InChI | InChI=1S/C22H12F7NO3/c1-32-11-4-2-10(3-5-11)9-30-16-7-12(13-6-15(24)19(26)20(27)18(13)25)14(23)8-17(16)33-22(28,29)21(30)31/h2-8H,9H2,1H3 |
| InChIKey | QREHMOUBPUAXIQ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.33 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|