C21H23FO2 — CID 175927723
[3-(2,2-dimethylpent-4-ynyl)-4-(2-fluoro-5-methoxyphenyl)phenyl]methanol (PubChem CID 175927723) has the molecular formula C21H23FO2 and a molecular weight of 326.41 g/mol. Its IUPAC name is [3-(2,2-dimethylpent-4-ynyl)-4-(2-fluoro-5-methoxyphenyl)phenyl]methanol.
| Compound Name | [3-(2,2-dimethylpent-4-ynyl)-4-(2-fluoro-5-methoxyphenyl)phenyl]methanol |
|---|---|
| PubChem CID | 175927723 |
| Molecular Formula | C21H23FO2 |
| Molecular Weight | 326.41 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | [3-(2,2-dimethylpent-4-ynyl)-4-(2-fluoro-5-methoxyphenyl)phenyl]methanol |
| SMILES | C#CCC(C)(C)Cc1cc(CO)ccc1-c1cc(OC)ccc1F |
| InChI | InChI=1S/C21H23FO2/c1-5-10-21(2,3)13-16-11-15(14-23)6-8-18(16)19-12-17(24-4)7-9-20(19)22/h1,6-9,11-12,23H,10,13-14H2,2-4H3 |
| InChIKey | VEJMZECSBFPPGK-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.41 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|