C28H28O7 — CID 175929555
[4-[(E)-3-(3-acetyl-4-methylphenyl)prop-2-enoyl]oxyoxolan-3-yl] 3-(3-acetyl-4-methylphenyl)prop-2-enoate (PubChem CID 175929555) has the molecular formula C28H28O7 and a molecular weight of 476.53 g/mol. Its IUPAC name is [4-[(E)-3-(3-acetyl-4-methylphenyl)prop-2-enoyl]oxyoxolan-3-yl] 3-(3-acetyl-4-methylphenyl)prop-2-enoate.
| Compound Name | [4-[(E)-3-(3-acetyl-4-methylphenyl)prop-2-enoyl]oxyoxolan-3-yl] 3-(3-acetyl-4-methylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 175929555 |
| Molecular Formula | C28H28O7 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | [4-[(E)-3-(3-acetyl-4-methylphenyl)prop-2-enoyl]oxyoxolan-3-yl] 3-(3-acetyl-4-methylphenyl)prop-2-enoate |
| SMILES | CC(=O)c1cc(C=CC(=O)OC2COCC2OC(=O)/C=C/c2ccc(C)c(C(C)=O)c2)ccc1C |
| InChI | InChI=1S/C28H28O7/c1-17-5-7-21(13-23(17)19(3)29)9-11-27(31)34-25-15-33-16-26(25)35-28(32)12-10-22-8-6-18(2)24(14-22)20(4)30/h5-14,25-26H,15-16H2,1-4H3/b11-9+,12-10? |
| InChIKey | RNZJHEHQZYDYNA-IQYMAPIOSA-N |
| XLogP | 4.29 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|