C16H13NO2S2 — CID 175933098
4-benzylisoindole-1,3-dione;methanedithioic acid (PubChem CID 175933098) has the molecular formula C16H13NO2S2 and a molecular weight of 315.42 g/mol. Its IUPAC name is 4-benzylisoindole-1,3-dione;methanedithioic acid.
| Compound Name | 4-benzylisoindole-1,3-dione;methanedithioic acid |
|---|---|
| PubChem CID | 175933098 |
| Molecular Formula | C16H13NO2S2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | 4-benzylisoindole-1,3-dione;methanedithioic acid |
| SMILES | O=C1NC(=O)c2c(Cc3ccccc3)cccc21.S=CS |
| InChI | InChI=1S/C15H11NO2.CH2S2/c17-14-12-8-4-7-11(13(12)15(18)16-14)9-10-5-2-1-3-6-10;2-1-3/h1-8H,9H2,(H,16,17,18);1H,(H,2,3) |
| InChIKey | GWAIPJKLYGJMDJ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|