C10H10F2N2 — CID 175933768
6,6-difluoro-3-pyridin-2-yl-3-azabicyclo[3.1.0]hexane (PubChem CID 175933768) has the molecular formula C10H10F2N2 and a molecular weight of 196.20 g/mol. Its IUPAC name is 6,6-difluoro-3-pyridin-2-yl-3-azabicyclo[3.1.0]hexane.
| Compound Name | 6,6-difluoro-3-pyridin-2-yl-3-azabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 175933768 |
| Molecular Formula | C10H10F2N2 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 6,6-difluoro-3-pyridin-2-yl-3-azabicyclo[3.1.0]hexane |
| SMILES | FC1(F)C2CN(c3ccccn3)CC21 |
| InChI | InChI=1S/C10H10F2N2/c11-10(12)7-5-14(6-8(7)10)9-3-1-2-4-13-9/h1-4,7-8H,5-6H2 |
| InChIKey | BPOBMXCUANPDGE-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |