C10H10BF2N2O2 — CID 140811107
CID 140811107 (PubChem CID 140811107) has the molecular formula C10H10BF2N2O2 and a molecular weight of 239.01 g/mol.
| Compound Name | CID 140811107 |
|---|---|
| PubChem CID | 140811107 |
| Molecular Formula | C10H10BF2N2O2 |
| Molecular Weight | 239.01 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | — |
| SMILES | O[B]Oc1ccc(N2CC3C(C2)C3(F)F)nc1 |
| InChI | InChI=1S/C10H10BF2N2O2/c12-10(13)7-4-15(5-8(7)10)9-2-1-6(3-14-9)17-11-16/h1-3,7-8,16H,4-5H2 |
| InChIKey | BPHWXJLTLATPOX-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.01 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|