About 6-[6-[(5R)-6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl]-3-pyridinyl]pyridin-2-amine
6-[6-[(5R)-6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl]-3-pyridinyl]pyridin-2-amine (PubChem CID 146223344) has the molecular formula C15H14F2N4
and a molecular weight of 288.30 g/mol. Its IUPAC name is 6-[6-[(5R)-6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl]-3-pyridinyl]pyridin-2-amine.
Molecular Properties
| Compound Name | 6-[6-[(5R)-6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl]-3-pyridinyl]pyridin-2-amine |
| PubChem CID | 146223344 |
| Molecular Formula | C15H14F2N4 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 6-[6-[(5R)-6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl]-3-pyridinyl]pyridin-2-amine |
| SMILES | Nc1cccc(-c2ccc(N3CC4[C@H](C3)C4(F)F)nc2)n1 |
| InChI | InChI=1S/C15H14F2N4/c16-15(17)10-7-21(8-11(10)15)14-5-4-9(6-19-14)12-2-1-3-13(18)20-12/h1-6,10-11H,7-8H2,(H2,18,20)/t10-,11?/m0/s1 |
| InChIKey | PXIKNSACAWGMQY-VUWPPUDQSA-N |
| XLogP | 2.43 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-[6-[(5R)-6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl]-3-pyridinyl]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[6-[(5R)-6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl]-3-pyridinyl]pyridin-2-amine?
The IUPAC name of 6-[6-[(5R)-6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl]-3-pyridinyl]pyridin-2-amine (CID 146223344) is 6-[6-[(5R)-6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl]-3-pyridinyl]pyridin-2-amine.
What is the SMILES notation for 6-[6-[(5R)-6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl]-3-pyridinyl]pyridin-2-amine?
The canonical SMILES for 6-[6-[(5R)-6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl]-3-pyridinyl]pyridin-2-amine is Nc1cccc(-c2ccc(N3CC4[C@H](C3)C4(F)F)nc2)n1.
What is the InChIKey of 6-[6-[(5R)-6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl]-3-pyridinyl]pyridin-2-amine?
The InChIKey is PXIKNSACAWGMQY-VUWPPUDQSA-N. The full InChI is InChI=1S/C15H14F2N4/c16-15(17)10-7-21(8-11(10)15)14-5-4-9(6-19-14)12-2-1-3-13(18)20-12/h1-6,10-11H,7-8H2,(H2,18,20)/t10-,11?/m0/s1.
What are the key properties of 6-[6-[(5R)-6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl]-3-pyridinyl]pyridin-2-amine?
6-[6-[(5R)-6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl]-3-pyridinyl]pyridin-2-amine has a molecular weight of 288.30 g/mol, XLogP of 2.43, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[6-[(5R)-6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl]-3-pyridinyl]pyridin-2-amine is sourced from PubChem (CID 146223344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).