C12H12ClF2N3O — CID 118961268
2-chloro-N-[6-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)-2-pyridinyl]acetamide (PubChem CID 118961268) has the molecular formula C12H12ClF2N3O and a molecular weight of 287.70 g/mol. Its IUPAC name is 2-chloro-N-[6-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)-2-pyridinyl]acetamide.
| Compound Name | 2-chloro-N-[6-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 118961268 |
| Molecular Formula | C12H12ClF2N3O |
| Molecular Weight | 287.70 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 2-chloro-N-[6-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)-2-pyridinyl]acetamide |
| SMILES | O=C(CCl)Nc1cccc(N2CC3C(C2)C3(F)F)n1 |
| InChI | InChI=1S/C12H12ClF2N3O/c13-4-11(19)17-9-2-1-3-10(16-9)18-5-7-8(6-18)12(7,14)15/h1-3,7-8H,4-6H2,(H,16,17,19) |
| InChIKey | MCDZDTBMPIEPOX-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.70 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|