About 2-[6-(3-azabicyclo[3.1.0]hexan-3-yl)-3-pyridinyl]-1,3-thiazol-4-amine;ethane
2-[6-(3-azabicyclo[3.1.0]hexan-3-yl)-3-pyridinyl]-1,3-thiazol-4-amine;ethane (PubChem CID 145049338) has the molecular formula C15H20N4S
and a molecular weight of 288.42 g/mol. Its IUPAC name is 2-[6-(3-azabicyclo[3.1.0]hexan-3-yl)-3-pyridinyl]-1,3-thiazol-4-amine;ethane.
Molecular Properties
| Compound Name | 2-[6-(3-azabicyclo[3.1.0]hexan-3-yl)-3-pyridinyl]-1,3-thiazol-4-amine;ethane |
| PubChem CID | 145049338 |
| Molecular Formula | C15H20N4S |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 2-[6-(3-azabicyclo[3.1.0]hexan-3-yl)-3-pyridinyl]-1,3-thiazol-4-amine;ethane |
| SMILES | CC.Nc1csc(-c2ccc(N3CC4CC4C3)nc2)n1 |
| InChI | InChI=1S/C13H14N4S.C2H6/c14-11-7-18-13(16-11)8-1-2-12(15-4-8)17-5-9-3-10(9)6-17;1-2/h1-2,4,7,9-10H,3,5-6,14H2;1-2H3 |
| InChIKey | QMYARFMALJZFHC-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[6-(3-azabicyclo[3.1.0]hexan-3-yl)-3-pyridinyl]-1,3-thiazol-4-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-(3-azabicyclo[3.1.0]hexan-3-yl)-3-pyridinyl]-1,3-thiazol-4-amine;ethane?
The IUPAC name of 2-[6-(3-azabicyclo[3.1.0]hexan-3-yl)-3-pyridinyl]-1,3-thiazol-4-amine;ethane (CID 145049338) is 2-[6-(3-azabicyclo[3.1.0]hexan-3-yl)-3-pyridinyl]-1,3-thiazol-4-amine;ethane.
What is the SMILES notation for 2-[6-(3-azabicyclo[3.1.0]hexan-3-yl)-3-pyridinyl]-1,3-thiazol-4-amine;ethane?
The canonical SMILES for 2-[6-(3-azabicyclo[3.1.0]hexan-3-yl)-3-pyridinyl]-1,3-thiazol-4-amine;ethane is CC.Nc1csc(-c2ccc(N3CC4CC4C3)nc2)n1.
What is the InChIKey of 2-[6-(3-azabicyclo[3.1.0]hexan-3-yl)-3-pyridinyl]-1,3-thiazol-4-amine;ethane?
The InChIKey is QMYARFMALJZFHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N4S.C2H6/c14-11-7-18-13(16-11)8-1-2-12(15-4-8)17-5-9-3-10(9)6-17;1-2/h1-2,4,7,9-10H,3,5-6,14H2;1-2H3.
What are the key properties of 2-[6-(3-azabicyclo[3.1.0]hexan-3-yl)-3-pyridinyl]-1,3-thiazol-4-amine;ethane?
2-[6-(3-azabicyclo[3.1.0]hexan-3-yl)-3-pyridinyl]-1,3-thiazol-4-amine;ethane has a molecular weight of 288.42 g/mol, XLogP of 3.27, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-(3-azabicyclo[3.1.0]hexan-3-yl)-3-pyridinyl]-1,3-thiazol-4-amine;ethane is sourced from PubChem (CID 145049338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).