C8H6IN3S — CID 135232785
2-(6-iodo-3-pyridinyl)-1,3-thiazol-4-amine (PubChem CID 135232785) has the molecular formula C8H6IN3S and a molecular weight of 303.13 g/mol. Its IUPAC name is 2-(6-iodo-3-pyridinyl)-1,3-thiazol-4-amine.
| Compound Name | 2-(6-iodo-3-pyridinyl)-1,3-thiazol-4-amine |
|---|---|
| PubChem CID | 135232785 |
| Molecular Formula | C8H6IN3S |
| Molecular Weight | 303.13 g/mol |
| Exact Mass | 302.93 |
| IUPAC Name | 2-(6-iodo-3-pyridinyl)-1,3-thiazol-4-amine |
| SMILES | Nc1csc(-c2ccc(I)nc2)n1 |
| InChI | InChI=1S/C8H6IN3S/c9-6-2-1-5(3-11-6)8-12-7(10)4-13-8/h1-4H,10H2 |
| InChIKey | FWNYYXSDYPMBRR-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.13 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|