C7H5IN4S — CID 135232511
2-(5-iodopyrazin-2-yl)-1,3-thiazol-4-amine (PubChem CID 135232511) has the molecular formula C7H5IN4S and a molecular weight of 304.12 g/mol. Its IUPAC name is 2-(5-iodopyrazin-2-yl)-1,3-thiazol-4-amine.
| Compound Name | 2-(5-iodopyrazin-2-yl)-1,3-thiazol-4-amine |
|---|---|
| PubChem CID | 135232511 |
| Molecular Formula | C7H5IN4S |
| Molecular Weight | 304.12 g/mol |
| Exact Mass | 303.93 |
| IUPAC Name | 2-(5-iodopyrazin-2-yl)-1,3-thiazol-4-amine |
| SMILES | Nc1csc(-c2cnc(I)cn2)n1 |
| InChI | InChI=1S/C7H5IN4S/c8-5-2-10-4(1-11-5)7-12-6(9)3-13-7/h1-3H,9H2 |
| InChIKey | KTRFVSCDAUSIBQ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.12 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|