About 2-(5-iodopyrazin-2-yl)-1,3-thiazol-4-amine
2-(5-iodopyrazin-2-yl)-1,3-thiazol-4-amine (PubChem CID 135232511) has the molecular formula C7H5IN4S
and a molecular weight of 304.12 g/mol. Its IUPAC name is 2-(5-iodopyrazin-2-yl)-1,3-thiazol-4-amine.
Molecular Properties
| Compound Name | 2-(5-iodopyrazin-2-yl)-1,3-thiazol-4-amine |
| PubChem CID | 135232511 |
| Molecular Formula | C7H5IN4S |
| Molecular Weight | 304.12 g/mol |
| Exact Mass | 303.93 |
| IUPAC Name | 2-(5-iodopyrazin-2-yl)-1,3-thiazol-4-amine |
| SMILES | Nc1csc(-c2cnc(I)cn2)n1 |
| InChI | InChI=1S/C7H5IN4S/c8-5-2-10-4(1-11-5)7-12-6(9)3-13-7/h1-3H,9H2 |
| InChIKey | KTRFVSCDAUSIBQ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.12 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-iodopyrazin-2-yl)-1,3-thiazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-iodopyrazin-2-yl)-1,3-thiazol-4-amine?
The IUPAC name of 2-(5-iodopyrazin-2-yl)-1,3-thiazol-4-amine (CID 135232511) is 2-(5-iodopyrazin-2-yl)-1,3-thiazol-4-amine.
What is the SMILES notation for 2-(5-iodopyrazin-2-yl)-1,3-thiazol-4-amine?
The canonical SMILES for 2-(5-iodopyrazin-2-yl)-1,3-thiazol-4-amine is Nc1csc(-c2cnc(I)cn2)n1.
What is the InChIKey of 2-(5-iodopyrazin-2-yl)-1,3-thiazol-4-amine?
The InChIKey is KTRFVSCDAUSIBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5IN4S/c8-5-2-10-4(1-11-5)7-12-6(9)3-13-7/h1-3H,9H2.
What are the key properties of 2-(5-iodopyrazin-2-yl)-1,3-thiazol-4-amine?
2-(5-iodopyrazin-2-yl)-1,3-thiazol-4-amine has a molecular weight of 304.12 g/mol, XLogP of 1.79, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-iodopyrazin-2-yl)-1,3-thiazol-4-amine is sourced from PubChem (CID 135232511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).