C12H17N3S — CID 143780879
ethane;2-(6-ethyl-3-pyridinyl)-1,3-thiazol-4-amine (PubChem CID 143780879) has the molecular formula C12H17N3S and a molecular weight of 235.36 g/mol. Its IUPAC name is ethane;2-(6-ethyl-3-pyridinyl)-1,3-thiazol-4-amine.
| Compound Name | ethane;2-(6-ethyl-3-pyridinyl)-1,3-thiazol-4-amine |
|---|---|
| PubChem CID | 143780879 |
| Molecular Formula | C12H17N3S |
| Molecular Weight | 235.36 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | ethane;2-(6-ethyl-3-pyridinyl)-1,3-thiazol-4-amine |
| SMILES | CC.CCc1ccc(-c2nc(N)cs2)cn1 |
| InChI | InChI=1S/C10H11N3S.C2H6/c1-2-8-4-3-7(5-12-8)10-13-9(11)6-14-10;1-2/h3-6H,2,11H2,1H3;1-2H3 |
| InChIKey | YNEDLAXCEVMHDE-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.36 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |