C12H14N2S2 — CID 116864233
2-(4-propan-2-ylsulfanylphenyl)-1,3-thiazol-4-amine (PubChem CID 116864233) has the molecular formula C12H14N2S2 and a molecular weight of 250.39 g/mol. Its IUPAC name is 2-(4-propan-2-ylsulfanylphenyl)-1,3-thiazol-4-amine.
| Compound Name | 2-(4-propan-2-ylsulfanylphenyl)-1,3-thiazol-4-amine |
|---|---|
| PubChem CID | 116864233 |
| Molecular Formula | C12H14N2S2 |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 2-(4-propan-2-ylsulfanylphenyl)-1,3-thiazol-4-amine |
| SMILES | CC(C)Sc1ccc(-c2nc(N)cs2)cc1 |
| InChI | InChI=1S/C12H14N2S2/c1-8(2)16-10-5-3-9(4-6-10)12-14-11(13)7-15-12/h3-8H,13H2,1-2H3 |
| InChIKey | PERZXPKETGEAKN-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |