C13H15NOS2 — CID 116867448
[4-(4-propan-2-ylsulfanylphenyl)-1,3-thiazol-2-yl]methanol (PubChem CID 116867448) has the molecular formula C13H15NOS2 and a molecular weight of 265.40 g/mol. Its IUPAC name is [4-(4-propan-2-ylsulfanylphenyl)-1,3-thiazol-2-yl]methanol.
| Compound Name | [4-(4-propan-2-ylsulfanylphenyl)-1,3-thiazol-2-yl]methanol |
|---|---|
| PubChem CID | 116867448 |
| Molecular Formula | C13H15NOS2 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | [4-(4-propan-2-ylsulfanylphenyl)-1,3-thiazol-2-yl]methanol |
| SMILES | CC(C)Sc1ccc(-c2csc(CO)n2)cc1 |
| InChI | InChI=1S/C13H15NOS2/c1-9(2)17-11-5-3-10(4-6-11)12-8-16-13(7-15)14-12/h3-6,8-9,15H,7H2,1-2H3 |
| InChIKey | VJMIOTZUZSFYHT-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |