C45H53N — CID 175939936
4,5-bis(2-butylphenyl)-2,3-bis(4-tert-butylphenyl)pyridine (PubChem CID 175939936) has the molecular formula C45H53N and a molecular weight of 607.93 g/mol. Its IUPAC name is 4,5-bis(2-butylphenyl)-2,3-bis(4-tert-butylphenyl)pyridine.
| Compound Name | 4,5-bis(2-butylphenyl)-2,3-bis(4-tert-butylphenyl)pyridine |
|---|---|
| PubChem CID | 175939936 |
| Molecular Formula | C45H53N |
| Molecular Weight | 607.93 g/mol |
| Exact Mass | 607.42 |
| IUPAC Name | 4,5-bis(2-butylphenyl)-2,3-bis(4-tert-butylphenyl)pyridine |
| SMILES | CCCCc1ccccc1-c1cnc(-c2ccc(C(C)(C)C)cc2)c(-c2ccc(C(C)(C)C)cc2)c1-c1ccccc1CCCC |
| InChI | InChI=1S/C45H53N/c1-9-11-17-32-19-13-15-21-38(32)40-31-46-43(35-25-29-37(30-26-35)45(6,7)8)41(34-23-27-36(28-24-34)44(3,4)5)42(40)39-22-16-14-20-33(39)18-12-10-2/h13-16,19-31H,9-12,17-18H2,1-8H3 |
| InChIKey | WWHMDXJMGRFCPQ-UHFFFAOYSA-N |
| XLogP | 13.03 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.93 |
| LogP ≤ 5 | 13.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |