C18H21FO2 — CID 175942613
cyclopropyl-[1-[(3-fluoro-4-methylphenyl)methyl]-3-hydroxycyclohex-2-en-1-yl]methanone (PubChem CID 175942613) has the molecular formula C18H21FO2 and a molecular weight of 288.36 g/mol. Its IUPAC name is cyclopropyl-[1-[(3-fluoro-4-methylphenyl)methyl]-3-hydroxycyclohex-2-en-1-yl]methanone.
| Compound Name | cyclopropyl-[1-[(3-fluoro-4-methylphenyl)methyl]-3-hydroxycyclohex-2-en-1-yl]methanone |
|---|---|
| PubChem CID | 175942613 |
| Molecular Formula | C18H21FO2 |
| Molecular Weight | 288.36 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | cyclopropyl-[1-[(3-fluoro-4-methylphenyl)methyl]-3-hydroxycyclohex-2-en-1-yl]methanone |
| SMILES | Cc1ccc(CC2(C(=O)C3CC3)C=C(O)CCC2)cc1F |
| InChI | InChI=1S/C18H21FO2/c1-12-4-5-13(9-16(12)19)10-18(17(21)14-6-7-14)8-2-3-15(20)11-18/h4-5,9,11,14,20H,2-3,6-8,10H2,1H3 |
| InChIKey | PCCPOAPQUBDXHU-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.36 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |