C25H23FN6O — CID 175947345
4-[4-(6-azaspiro[2.5]octan-6-yl)anilino]-2-(4-fluorophenyl)-6H-pyrimido[4,5-d]pyridazin-5-one (PubChem CID 175947345) has the molecular formula C25H23FN6O and a molecular weight of 442.50 g/mol. Its IUPAC name is 4-[4-(6-azaspiro[2.5]octan-6-yl)anilino]-2-(4-fluorophenyl)-6H-pyrimido[4,5-d]pyridazin-5-one.
| Compound Name | 4-[4-(6-azaspiro[2.5]octan-6-yl)anilino]-2-(4-fluorophenyl)-6H-pyrimido[4,5-d]pyridazin-5-one |
|---|---|
| PubChem CID | 175947345 |
| Molecular Formula | C25H23FN6O |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | 4-[4-(6-azaspiro[2.5]octan-6-yl)anilino]-2-(4-fluorophenyl)-6H-pyrimido[4,5-d]pyridazin-5-one |
| SMILES | O=c1[nH]ncc2nc(-c3ccc(F)cc3)nc(Nc3ccc(N4CCC5(CC4)CC5)cc3)c12 |
| InChI | InChI=1S/C25H23FN6O/c26-17-3-1-16(2-4-17)22-29-20-15-27-31-24(33)21(20)23(30-22)28-18-5-7-19(8-6-18)32-13-11-25(9-10-25)12-14-32/h1-8,15H,9-14H2,(H,31,33)(H,28,29,30) |
| InChIKey | GKLRUHLRIIULTA-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|