C22H32N6O5S — CID 175947396
4-[[(2S)-3-methyl-2-[6-(2-methylsulfonylpyrimidin-5-yl)hex-5-ynoylamino]butanoyl]amino]piperidine-4-carboxamide (PubChem CID 175947396) has the molecular formula C22H32N6O5S and a molecular weight of 492.60 g/mol. Its IUPAC name is 4-[[(2S)-3-methyl-2-[6-(2-methylsulfonylpyrimidin-5-yl)hex-5-ynoylamino]butanoyl]amino]piperidine-4-carboxamide.
| Compound Name | 4-[[(2S)-3-methyl-2-[6-(2-methylsulfonylpyrimidin-5-yl)hex-5-ynoylamino]butanoyl]amino]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 175947396 |
| Molecular Formula | C22H32N6O5S |
| Molecular Weight | 492.60 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | 4-[[(2S)-3-methyl-2-[6-(2-methylsulfonylpyrimidin-5-yl)hex-5-ynoylamino]butanoyl]amino]piperidine-4-carboxamide |
| SMILES | CC(C)[C@H](NC(=O)CCCC#Cc1cnc(S(C)(=O)=O)nc1)C(=O)NC1(C(N)=O)CCNCC1 |
| InChI | InChI=1S/C22H32N6O5S/c1-15(2)18(19(30)28-22(20(23)31)9-11-24-12-10-22)27-17(29)8-6-4-5-7-16-13-25-21(26-14-16)34(3,32)33/h13-15,18,24H,4,6,8-12H2,1-3H3,(H2,23,31)(H,27,29)(H,28,30)/t18-/m0/s1 |
| InChIKey | VEHLXVKXFBFUKW-SFHVURJKSA-N |
| XLogP | -0.73 |
| TPSA | 173.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.60 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|