C35H54N6O4 — CID 178047081
(2S)-N-(2-cyclopropyl-2-oxoethyl)-2-[[(2S)-2-[6-(2-cyclopropylpyrimidin-5-yl)hex-5-ynoylamino]-3-methylbutanoyl]amino]-6-(dipropylamino)hexanamide (PubChem CID 178047081) has the molecular formula C35H54N6O4 and a molecular weight of 622.86 g/mol. Its IUPAC name is (2S)-N-(2-cyclopropyl-2-oxoethyl)-2-[[(2S)-2-[6-(2-cyclopropylpyrimidin-5-yl)hex-5-ynoylamino]-3-methylbutanoyl]amino]-6-(dipropylamino)hexanamide.
| Compound Name | (2S)-N-(2-cyclopropyl-2-oxoethyl)-2-[[(2S)-2-[6-(2-cyclopropylpyrimidin-5-yl)hex-5-ynoylamino]-3-methylbutanoyl]amino]-6-(dipropylamino)hexanamide |
|---|---|
| PubChem CID | 178047081 |
| Molecular Formula | C35H54N6O4 |
| Molecular Weight | 622.86 g/mol |
| Exact Mass | 622.42 |
| IUPAC Name | (2S)-N-(2-cyclopropyl-2-oxoethyl)-2-[[(2S)-2-[6-(2-cyclopropylpyrimidin-5-yl)hex-5-ynoylamino]-3-methylbutanoyl]amino]-6-(dipropylamino)hexanamide |
| SMILES | CCCN(CCC)CCCC[C@H](NC(=O)[C@@H](NC(=O)CCCC#Cc1cnc(C2CC2)nc1)C(C)C)C(=O)NCC(=O)C1CC1 |
| InChI | InChI=1S/C35H54N6O4/c1-5-19-41(20-6-2)21-11-10-13-29(34(44)38-24-30(42)27-15-16-27)39-35(45)32(25(3)4)40-31(43)14-9-7-8-12-26-22-36-33(37-23-26)28-17-18-28/h22-23,25,27-29,32H,5-7,9-11,13-21,24H2,1-4H3,(H,38,44)(H,39,45)(H,40,43)/t29-,32-/m0/s1 |
| InChIKey | DCDZOAONLYVFKA-NYDCQLBNSA-N |
| XLogP | 3.89 |
| TPSA | 133.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.86 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|