C40H61N7O7S — CID 177324434
[4-[[5-(carbamoylamino)-2-[[3-methyl-2-[7-(2-pentan-3-ylsulfanylpyrimidin-5-yl)hept-6-ynoylamino]butanoyl]amino]pentanoyl]amino]phenyl]methyl hydrogen carbonate;pentane (PubChem CID 177324434) has the molecular formula C40H61N7O7S and a molecular weight of 784.04 g/mol. Its IUPAC name is [4-[[5-(carbamoylamino)-2-[[3-methyl-2-[7-(2-pentan-3-ylsulfanylpyrimidin-5-yl)hept-6-ynoylamino]butanoyl]amino]pentanoyl]amino]phenyl]methyl hydrogen carbonate;pentane.
| Compound Name | [4-[[5-(carbamoylamino)-2-[[3-methyl-2-[7-(2-pentan-3-ylsulfanylpyrimidin-5-yl)hept-6-ynoylamino]butanoyl]amino]pentanoyl]amino]phenyl]methyl hydrogen carbonate;pentane |
|---|---|
| PubChem CID | 177324434 |
| Molecular Formula | C40H61N7O7S |
| Molecular Weight | 784.04 g/mol |
| Exact Mass | 783.44 |
| IUPAC Name | [4-[[5-(carbamoylamino)-2-[[3-methyl-2-[7-(2-pentan-3-ylsulfanylpyrimidin-5-yl)hept-6-ynoylamino]butanoyl]amino]pentanoyl]amino]phenyl]methyl hydrogen carbonate;pentane |
| SMILES | CCC(CC)Sc1ncc(C#CCCCCC(=O)NC(C(=O)NC(CCCNC(N)=O)C(=O)Nc2ccc(COC(=O)O)cc2)C(C)C)cn1.CCCCC |
| InChI | InChI=1S/C35H49N7O7S.C5H12/c1-5-27(6-2)50-34-38-20-25(21-39-34)12-9-7-8-10-14-29(43)42-30(23(3)4)32(45)41-28(13-11-19-37-33(36)46)31(44)40-26-17-15-24(16-18-26)22-49-35(47)48;1-3-5-4-2/h15-18,20-21,23,27-28,30H,5-8,10-11,13-14,19,22H2,1-4H3,(H,40,44)(H,41,45)(H,42,43)(H,47,48)(H3,36,37,46);3-5H2,1-2H3 |
| InChIKey | XLXBDJXTHBZLOC-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 214.73 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.04 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|