C23H46N4O3 — CID 171408305
(2S)-6-(dibutylamino)-2-[[(2S)-3-methyl-2-(methylamino)butanoyl]amino]-N-(2-oxopropyl)hexanamide (PubChem CID 171408305) has the molecular formula C23H46N4O3 and a molecular weight of 426.65 g/mol. Its IUPAC name is (2S)-6-(dibutylamino)-2-[[(2S)-3-methyl-2-(methylamino)butanoyl]amino]-N-(2-oxopropyl)hexanamide.
| Compound Name | (2S)-6-(dibutylamino)-2-[[(2S)-3-methyl-2-(methylamino)butanoyl]amino]-N-(2-oxopropyl)hexanamide |
|---|---|
| PubChem CID | 171408305 |
| Molecular Formula | C23H46N4O3 |
| Molecular Weight | 426.65 g/mol |
| Exact Mass | 426.36 |
| IUPAC Name | (2S)-6-(dibutylamino)-2-[[(2S)-3-methyl-2-(methylamino)butanoyl]amino]-N-(2-oxopropyl)hexanamide |
| SMILES | CCCCN(CCCC)CCCC[C@H](NC(=O)[C@@H](NC)C(C)C)C(=O)NCC(C)=O |
| InChI | InChI=1S/C23H46N4O3/c1-7-9-14-27(15-10-8-2)16-12-11-13-20(22(29)25-17-19(5)28)26-23(30)21(24-6)18(3)4/h18,20-21,24H,7-17H2,1-6H3,(H,25,29)(H,26,30)/t20-,21-/m0/s1 |
| InChIKey | JVYNCWJCWZJLPD-SFTDATJTSA-N |
| XLogP | 2.49 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.65 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|