C15H30N4O3 — CID 171408391
(2S)-2-amino-6-[[(2S)-3-methyl-2-(methylamino)butanoyl]amino]-N-(2-oxopropyl)hexanamide (PubChem CID 171408391) has the molecular formula C15H30N4O3 and a molecular weight of 314.43 g/mol. Its IUPAC name is (2S)-2-amino-6-[[(2S)-3-methyl-2-(methylamino)butanoyl]amino]-N-(2-oxopropyl)hexanamide.
| Compound Name | (2S)-2-amino-6-[[(2S)-3-methyl-2-(methylamino)butanoyl]amino]-N-(2-oxopropyl)hexanamide |
|---|---|
| PubChem CID | 171408391 |
| Molecular Formula | C15H30N4O3 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.23 |
| IUPAC Name | (2S)-2-amino-6-[[(2S)-3-methyl-2-(methylamino)butanoyl]amino]-N-(2-oxopropyl)hexanamide |
| SMILES | CN[C@H](C(=O)NCCCC[C@H](N)C(=O)NCC(C)=O)C(C)C |
| InChI | InChI=1S/C15H30N4O3/c1-10(2)13(17-4)15(22)18-8-6-5-7-12(16)14(21)19-9-11(3)20/h10,12-13,17H,5-9,16H2,1-4H3,(H,18,22)(H,19,21)/t12-,13-/m0/s1 |
| InChIKey | FKRVTBDITNKWNN-STQMWFEESA-N |
| XLogP | -0.45 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|