C17H34N4O3 — CID 176536801
ethane;3-methyl-2-(methylamino)-N-[6-[[1-(methylamino)-2-oxoethenyl]amino]-2-oxohexan-3-yl]butanamide (PubChem CID 176536801) has the molecular formula C17H34N4O3 and a molecular weight of 342.48 g/mol. Its IUPAC name is ethane;3-methyl-2-(methylamino)-N-[6-[[1-(methylamino)-2-oxoethenyl]amino]-2-oxohexan-3-yl]butanamide.
| Compound Name | ethane;3-methyl-2-(methylamino)-N-[6-[[1-(methylamino)-2-oxoethenyl]amino]-2-oxohexan-3-yl]butanamide |
|---|---|
| PubChem CID | 176536801 |
| Molecular Formula | C17H34N4O3 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.26 |
| IUPAC Name | ethane;3-methyl-2-(methylamino)-N-[6-[[1-(methylamino)-2-oxoethenyl]amino]-2-oxohexan-3-yl]butanamide |
| SMILES | CC.CNC(=C=O)NCCCC(NC(=O)C(NC)C(C)C)C(C)=O |
| InChI | InChI=1S/C15H28N4O3.C2H6/c1-10(2)14(17-5)15(22)19-12(11(3)21)7-6-8-18-13(9-20)16-4;1-2/h10,12,14,16-18H,6-8H2,1-5H3,(H,19,22);1-2H3 |
| InChIKey | FORYRQQUTIHVFR-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|