C14H27N5O4 — CID 145101471
2-(3-aminopropanoylamino)-N-[(3S)-6-(methylcarbamoylamino)-2-oxohexan-3-yl]propanamide (PubChem CID 145101471) has the molecular formula C14H27N5O4 and a molecular weight of 329.40 g/mol. Its IUPAC name is 2-(3-aminopropanoylamino)-N-[(3S)-6-(methylcarbamoylamino)-2-oxohexan-3-yl]propanamide.
| Compound Name | 2-(3-aminopropanoylamino)-N-[(3S)-6-(methylcarbamoylamino)-2-oxohexan-3-yl]propanamide |
|---|---|
| PubChem CID | 145101471 |
| Molecular Formula | C14H27N5O4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | 2-(3-aminopropanoylamino)-N-[(3S)-6-(methylcarbamoylamino)-2-oxohexan-3-yl]propanamide |
| SMILES | CNC(=O)NCCC[C@H](NC(=O)C(C)NC(=O)CCN)C(C)=O |
| InChI | InChI=1S/C14H27N5O4/c1-9(18-12(21)6-7-15)13(22)19-11(10(2)20)5-4-8-17-14(23)16-3/h9,11H,4-8,15H2,1-3H3,(H,18,21)(H,19,22)(H2,16,17,23)/t9?,11-/m0/s1 |
| InChIKey | RIIRFRKJNBEXBD-UMJHXOGRSA-N |
| XLogP | -1.38 |
| TPSA | 142.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|