C19H37BN4O4 — CID 174022615
CID 174022615 (PubChem CID 174022615) has the molecular formula C19H37BN4O4 and a molecular weight of 396.34 g/mol.
| Compound Name | CID 174022615 |
|---|---|
| PubChem CID | 174022615 |
| Molecular Formula | C19H37BN4O4 |
| Molecular Weight | 396.34 g/mol |
| Exact Mass | 396.29 |
| IUPAC Name | — |
| SMILES | [B]C(=O)CNC(=O)[C@H](CCCCN(CCC)CCC)NC(=O)[C@@H](NO)C(C)C |
| InChI | InChI=1S/C19H37BN4O4/c1-5-10-24(11-6-2)12-8-7-9-15(18(26)21-13-16(20)25)22-19(27)17(23-28)14(3)4/h14-15,17,23,28H,5-13H2,1-4H3,(H,21,26)(H,22,27)/t15-,17-/m0/s1 |
| InChIKey | IXIOHNYPUZXMDH-RDJZCZTQSA-N |
| XLogP | 0.58 |
| TPSA | 110.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.34 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|