C17H32BN5O4 — CID 174022636
CID 174022636 (PubChem CID 174022636) has the molecular formula C17H32BN5O4 and a molecular weight of 381.29 g/mol.
| Compound Name | CID 174022636 |
|---|---|
| PubChem CID | 174022636 |
| Molecular Formula | C17H32BN5O4 |
| Molecular Weight | 381.29 g/mol |
| Exact Mass | 381.25 |
| IUPAC Name | — |
| SMILES | [B]C(=O)CNC(=O)[C@H](CCCCN1CCNCC1)NC(=O)[C@@H](NO)C(C)C |
| InChI | InChI=1S/C17H32BN5O4/c1-12(2)15(22-27)17(26)21-13(16(25)20-11-14(18)24)5-3-4-8-23-9-6-19-7-10-23/h12-13,15,19,22,27H,3-11H2,1-2H3,(H,20,25)(H,21,26)/t13-,15-/m0/s1 |
| InChIKey | ZYCNXLQVKJHZQK-ZFWWWQNUSA-N |
| XLogP | -1.64 |
| TPSA | 122.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.29 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|