C26H40N6O4 — CID 170274767
(2S)-6-amino-2-[[(2S)-2-[6-(2-ethylpyrimidin-5-yl)hex-5-ynoylamino]-3-methylbutanoyl]amino]-N-(2-oxopropyl)hexanamide (PubChem CID 170274767) has the molecular formula C26H40N6O4 and a molecular weight of 500.64 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(2S)-2-[6-(2-ethylpyrimidin-5-yl)hex-5-ynoylamino]-3-methylbutanoyl]amino]-N-(2-oxopropyl)hexanamide.
| Compound Name | (2S)-6-amino-2-[[(2S)-2-[6-(2-ethylpyrimidin-5-yl)hex-5-ynoylamino]-3-methylbutanoyl]amino]-N-(2-oxopropyl)hexanamide |
|---|---|
| PubChem CID | 170274767 |
| Molecular Formula | C26H40N6O4 |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.31 |
| IUPAC Name | (2S)-6-amino-2-[[(2S)-2-[6-(2-ethylpyrimidin-5-yl)hex-5-ynoylamino]-3-methylbutanoyl]amino]-N-(2-oxopropyl)hexanamide |
| SMILES | CCc1ncc(C#CCCCC(=O)N[C@H](C(=O)N[C@@H](CCCCN)C(=O)NCC(C)=O)C(C)C)cn1 |
| InChI | InChI=1S/C26H40N6O4/c1-5-22-28-16-20(17-29-22)11-7-6-8-13-23(34)32-24(18(2)3)26(36)31-21(12-9-10-14-27)25(35)30-15-19(4)33/h16-18,21,24H,5-6,8-10,12-15,27H2,1-4H3,(H,30,35)(H,31,36)(H,32,34)/t21-,24-/m0/s1 |
| InChIKey | DAEHDQAYSHKSEN-URXFXBBRSA-N |
| XLogP | 1.02 |
| TPSA | 156.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|