C25H45N9O10 — CID 18942691
2-[[6-amino-2-[[2-[[2-[[2-[[2-[2-[(2-aminoacetyl)amino]propanoylamino]acetyl]amino]acetyl]amino]-3-methylbutanoyl]amino]acetyl]amino]hexanoyl]amino]-3-hydroxypropanoic acid (PubChem CID 18942691) has the molecular formula C25H45N9O10 and a molecular weight of 631.69 g/mol. Its IUPAC name is 2-[[6-amino-2-[[2-[[2-[[2-[[2-[2-[(2-aminoacetyl)amino]propanoylamino]acetyl]amino]acetyl]amino]-3-methylbutanoyl]amino]acetyl]amino]hexanoyl]amino]-3-hydroxypropanoic acid.
| Compound Name | 2-[[6-amino-2-[[2-[[2-[[2-[[2-[2-[(2-aminoacetyl)amino]propanoylamino]acetyl]amino]acetyl]amino]-3-methylbutanoyl]amino]acetyl]amino]hexanoyl]amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 18942691 |
| Molecular Formula | C25H45N9O10 |
| Molecular Weight | 631.69 g/mol |
| Exact Mass | 631.33 |
| IUPAC Name | 2-[[6-amino-2-[[2-[[2-[[2-[[2-[2-[(2-aminoacetyl)amino]propanoylamino]acetyl]amino]acetyl]amino]-3-methylbutanoyl]amino]acetyl]amino]hexanoyl]amino]-3-hydroxypropanoic acid |
| SMILES | CC(NC(=O)CN)C(=O)NCC(=O)NCC(=O)NC(C(=O)NCC(=O)NC(CCCCN)C(=O)NC(CO)C(=O)O)C(C)C |
| InChI | InChI=1S/C25H45N9O10/c1-13(2)21(34-20(39)10-28-18(37)9-29-22(40)14(3)31-17(36)8-27)24(42)30-11-19(38)32-15(6-4-5-7-26)23(41)33-16(12-35)25(43)44/h13-16,21,35H,4-12,26-27H2,1-3H3,(H,28,37)(H,29,40)(H,30,42)(H,31,36)(H,32,38)(H,33,41)(H,34,39)(H,43,44) |
| InChIKey | SRBXVZFGQFNESF-UHFFFAOYSA-N |
| XLogP | -5.89 |
| TPSA | 313.27 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.69 |
| LogP ≤ 5 | -5.89 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|