C23H23FN2O4 — CID 175947593
[(3R,6S)-6-[(1S)-1-(4-fluorophenyl)-3,4-dihydro-1H-isoquinoline-2-carbonyl]-4-methylideneoxan-3-yl] carbamate (PubChem CID 175947593) has the molecular formula C23H23FN2O4 and a molecular weight of 410.45 g/mol. Its IUPAC name is [(3R,6S)-6-[(1S)-1-(4-fluorophenyl)-3,4-dihydro-1H-isoquinoline-2-carbonyl]-4-methylideneoxan-3-yl] carbamate.
| Compound Name | [(3R,6S)-6-[(1S)-1-(4-fluorophenyl)-3,4-dihydro-1H-isoquinoline-2-carbonyl]-4-methylideneoxan-3-yl] carbamate |
|---|---|
| PubChem CID | 175947593 |
| Molecular Formula | C23H23FN2O4 |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | [(3R,6S)-6-[(1S)-1-(4-fluorophenyl)-3,4-dihydro-1H-isoquinoline-2-carbonyl]-4-methylideneoxan-3-yl] carbamate |
| SMILES | C=C1C[C@@H](C(=O)N2CCc3ccccc3[C@@H]2c2ccc(F)cc2)OC[C@@H]1OC(N)=O |
| InChI | InChI=1S/C23H23FN2O4/c1-14-12-19(29-13-20(14)30-23(25)28)22(27)26-11-10-15-4-2-3-5-18(15)21(26)16-6-8-17(24)9-7-16/h2-9,19-21H,1,10-13H2,(H2,25,28)/t19-,20-,21-/m0/s1 |
| InChIKey | JWKRSMMXGLBFEL-ACRUOGEOSA-N |
| XLogP | 3.11 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|