C6H8N2OS — CID 175948159
5-(1-ethoxyethenyl)-1,2,4-thiadiazole (PubChem CID 175948159) has the molecular formula C6H8N2OS and a molecular weight of 156.21 g/mol. Its IUPAC name is 5-(1-ethoxyethenyl)-1,2,4-thiadiazole.
| Compound Name | 5-(1-ethoxyethenyl)-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 175948159 |
| Molecular Formula | C6H8N2OS |
| Molecular Weight | 156.21 g/mol |
| Exact Mass | 156.04 |
| IUPAC Name | 5-(1-ethoxyethenyl)-1,2,4-thiadiazole |
| SMILES | C=C(OCC)c1ncns1 |
| InChI | InChI=1S/C6H8N2OS/c1-3-9-5(2)6-7-4-8-10-6/h4H,2-3H2,1H3 |
| InChIKey | JVBZNWCYIGLFCX-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.21 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|