C7H10N2OS — CID 170191437
5-(1-ethoxyethenyl)-3-methyl-1,2,4-thiadiazole (PubChem CID 170191437) has the molecular formula C7H10N2OS and a molecular weight of 170.24 g/mol. Its IUPAC name is 5-(1-ethoxyethenyl)-3-methyl-1,2,4-thiadiazole.
| Compound Name | 5-(1-ethoxyethenyl)-3-methyl-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 170191437 |
| Molecular Formula | C7H10N2OS |
| Molecular Weight | 170.24 g/mol |
| Exact Mass | 170.05 |
| IUPAC Name | 5-(1-ethoxyethenyl)-3-methyl-1,2,4-thiadiazole |
| SMILES | C=C(OCC)c1nc(C)ns1 |
| InChI | InChI=1S/C7H10N2OS/c1-4-10-5(2)7-8-6(3)9-11-7/h2,4H2,1,3H3 |
| InChIKey | IUBGDQCLASJMPA-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.24 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|