C8H14N2OS — CID 177332478
3-(1-ethoxypropyl)-5-methyl-1,2,4-thiadiazole (PubChem CID 177332478) has the molecular formula C8H14N2OS and a molecular weight of 186.28 g/mol. Its IUPAC name is 3-(1-ethoxypropyl)-5-methyl-1,2,4-thiadiazole.
| Compound Name | 3-(1-ethoxypropyl)-5-methyl-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 177332478 |
| Molecular Formula | C8H14N2OS |
| Molecular Weight | 186.28 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | 3-(1-ethoxypropyl)-5-methyl-1,2,4-thiadiazole |
| SMILES | CCOC(CC)c1nsc(C)n1 |
| InChI | InChI=1S/C8H14N2OS/c1-4-7(11-5-2)8-9-6(3)12-10-8/h7H,4-5H2,1-3H3 |
| InChIKey | HQULPFUVLBJBTF-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.28 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |