C22H21F2NO2 — CID 175949999
ethyl 3-[2,5-bis(4-fluorophenyl)-4-methyl-1H-pyrrol-3-yl]propanoate (PubChem CID 175949999) has the molecular formula C22H21F2NO2 and a molecular weight of 369.41 g/mol. Its IUPAC name is ethyl 3-[2,5-bis(4-fluorophenyl)-4-methyl-1H-pyrrol-3-yl]propanoate.
| Compound Name | ethyl 3-[2,5-bis(4-fluorophenyl)-4-methyl-1H-pyrrol-3-yl]propanoate |
|---|---|
| PubChem CID | 175949999 |
| Molecular Formula | C22H21F2NO2 |
| Molecular Weight | 369.41 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | ethyl 3-[2,5-bis(4-fluorophenyl)-4-methyl-1H-pyrrol-3-yl]propanoate |
| SMILES | CCOC(=O)CCc1c(-c2ccc(F)cc2)[nH]c(-c2ccc(F)cc2)c1C |
| InChI | InChI=1S/C22H21F2NO2/c1-3-27-20(26)13-12-19-14(2)21(15-4-8-17(23)9-5-15)25-22(19)16-6-10-18(24)11-7-16/h4-11,25H,3,12-13H2,1-2H3 |
| InChIKey | YMQMLOIKDGZPJL-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.41 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |