C10H16N2O4 — CID 175950638
2-hydroxyimino-N,N-bis(oxolan-3-yl)acetamide (PubChem CID 175950638) has the molecular formula C10H16N2O4 and a molecular weight of 228.25 g/mol. Its IUPAC name is 2-hydroxyimino-N,N-bis(oxolan-3-yl)acetamide.
| Compound Name | 2-hydroxyimino-N,N-bis(oxolan-3-yl)acetamide |
|---|---|
| PubChem CID | 175950638 |
| Molecular Formula | C10H16N2O4 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 2-hydroxyimino-N,N-bis(oxolan-3-yl)acetamide |
| SMILES | O=C(C=NO)N(C1CCOC1)C1CCOC1 |
| InChI | InChI=1S/C10H16N2O4/c13-10(5-11-14)12(8-1-3-15-6-8)9-2-4-16-7-9/h5,8-9,14H,1-4,6-7H2 |
| InChIKey | AMWGBEXJDYMZDF-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|