C4H11N3O — CID 123543095
N,N-diaminooxolan-3-amine (PubChem CID 123543095) has the molecular formula C4H11N3O and a molecular weight of 117.15 g/mol. Its IUPAC name is N,N-diaminooxolan-3-amine.
| Compound Name | N,N-diaminooxolan-3-amine |
|---|---|
| PubChem CID | 123543095 |
| Molecular Formula | C4H11N3O |
| Molecular Weight | 117.15 g/mol |
| Exact Mass | 117.09 |
| IUPAC Name | N,N-diaminooxolan-3-amine |
| SMILES | NN(N)C1CCOC1 |
| InChI | InChI=1S/C4H11N3O/c5-7(6)4-1-2-8-3-4/h4H,1-3,5-6H2 |
| InChIKey | SYOVMFLHELUWLP-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 64.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 117.15 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|