C21H24N2O — CID 175955311
2-amino-N,N-dibenzylbicyclo[2.1.1]hexane-1-carboxamide (PubChem CID 175955311) has the molecular formula C21H24N2O and a molecular weight of 320.44 g/mol. Its IUPAC name is 2-amino-N,N-dibenzylbicyclo[2.1.1]hexane-1-carboxamide.
| Compound Name | 2-amino-N,N-dibenzylbicyclo[2.1.1]hexane-1-carboxamide |
|---|---|
| PubChem CID | 175955311 |
| Molecular Formula | C21H24N2O |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | 2-amino-N,N-dibenzylbicyclo[2.1.1]hexane-1-carboxamide |
| SMILES | NC1CC2CC1(C(=O)N(Cc1ccccc1)Cc1ccccc1)C2 |
| InChI | InChI=1S/C21H24N2O/c22-19-11-18-12-21(19,13-18)20(24)23(14-16-7-3-1-4-8-16)15-17-9-5-2-6-10-17/h1-10,18-19H,11-15,22H2 |
| InChIKey | KKZURKGCFFUMBS-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |