C13H22F3NO3S — CID 175955467
butan-2-yl-oxido-[[8-(trifluoromethyl)-1,4-dioxaspiro[4.5]decan-8-yl]amino]sulfanium (PubChem CID 175955467) has the molecular formula C13H22F3NO3S and a molecular weight of 329.38 g/mol. Its IUPAC name is butan-2-yl-oxido-[[8-(trifluoromethyl)-1,4-dioxaspiro[4.5]decan-8-yl]amino]sulfanium.
| Compound Name | butan-2-yl-oxido-[[8-(trifluoromethyl)-1,4-dioxaspiro[4.5]decan-8-yl]amino]sulfanium |
|---|---|
| PubChem CID | 175955467 |
| Molecular Formula | C13H22F3NO3S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | butan-2-yl-oxido-[[8-(trifluoromethyl)-1,4-dioxaspiro[4.5]decan-8-yl]amino]sulfanium |
| SMILES | CCC(C)[S+]([O-])NC1(C(F)(F)F)CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C13H22F3NO3S/c1-3-10(2)21(18)17-11(13(14,15)16)4-6-12(7-5-11)19-8-9-20-12/h10,17H,3-9H2,1-2H3 |
| InChIKey | FJABIDIYHZSHCD-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 53.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|