C16H16F3N3O2 — CID 175955635
N-prop-2-enyl-N-[3-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]propyl]formamide (PubChem CID 175955635) has the molecular formula C16H16F3N3O2 and a molecular weight of 339.32 g/mol. Its IUPAC name is N-prop-2-enyl-N-[3-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]propyl]formamide.
| Compound Name | N-prop-2-enyl-N-[3-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]propyl]formamide |
|---|---|
| PubChem CID | 175955635 |
| Molecular Formula | C16H16F3N3O2 |
| Molecular Weight | 339.32 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | N-prop-2-enyl-N-[3-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]propyl]formamide |
| SMILES | C=CCN(C=O)CCCc1ccc(-c2noc(C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C16H16F3N3O2/c1-2-9-22(11-23)10-3-4-12-5-7-13(8-6-12)14-20-15(24-21-14)16(17,18)19/h2,5-8,11H,1,3-4,9-10H2 |
| InChIKey | WFMSZTLBBBCJQY-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.32 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|