C16H20F3N3O4 — CID 176697616
2-methoxypropane;N-methoxy-N-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]formamide (PubChem CID 176697616) has the molecular formula C16H20F3N3O4 and a molecular weight of 375.35 g/mol. Its IUPAC name is 2-methoxypropane;N-methoxy-N-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]formamide.
| Compound Name | 2-methoxypropane;N-methoxy-N-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]formamide |
|---|---|
| PubChem CID | 176697616 |
| Molecular Formula | C16H20F3N3O4 |
| Molecular Weight | 375.35 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | 2-methoxypropane;N-methoxy-N-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]formamide |
| SMILES | COC(C)C.CON(C=O)Cc1ccc(-c2noc(C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C12H10F3N3O3.C4H10O/c1-20-18(7-19)6-8-2-4-9(5-3-8)10-16-11(21-17-10)12(13,14)15;1-4(2)5-3/h2-5,7H,6H2,1H3;4H,1-3H3 |
| InChIKey | DAMGFKLYNOQQHW-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 77.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.35 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|