C9H13BO3 — CID 175955829
[2-ethyl-4-(hydroxymethyl)phenyl]boronic acid (PubChem CID 175955829) has the molecular formula C9H13BO3 and a molecular weight of 180.01 g/mol. Its IUPAC name is [2-ethyl-4-(hydroxymethyl)phenyl]boronic acid.
| Compound Name | [2-ethyl-4-(hydroxymethyl)phenyl]boronic acid |
|---|---|
| PubChem CID | 175955829 |
| Molecular Formula | C9H13BO3 |
| Molecular Weight | 180.01 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | [2-ethyl-4-(hydroxymethyl)phenyl]boronic acid |
| SMILES | CCc1cc(CO)ccc1B(O)O |
| InChI | InChI=1S/C9H13BO3/c1-2-8-5-7(6-11)3-4-9(8)10(12)13/h3-5,11-13H,2,6H2,1H3 |
| InChIKey | FBGYIBARMFXYGQ-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.01 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|