aminooxy-(2,4-diethylphenyl)borinic acid

C10H16BNO2 — CID 68784398

IUPACaminooxy-(2,4-diethylphenyl)borinic acid
SMILESCCc1ccc(B(O)ON)c(CC)c1
InChIInChI=1S/C10H16BNO2/c1-3-8-5-6-10(11(13)14-12)9(4-2)7-8/h5-7,13H,3-4,12H2,1-2H3
InChIKeyOGMRCCRPIQTXET-UHFFFAOYSA-N
MW193.06 g/mol
LogP0.39
Rot. Bonds4

About aminooxy-(2,4-diethylphenyl)borinic acid

aminooxy-(2,4-diethylphenyl)borinic acid (PubChem CID 68784398) has the molecular formula C10H16BNO2 and a molecular weight of 193.06 g/mol. Its IUPAC name is aminooxy-(2,4-diethylphenyl)borinic acid.

Molecular Properties

Compound Nameaminooxy-(2,4-diethylphenyl)borinic acid
PubChem CID68784398
Molecular FormulaC10H16BNO2
Molecular Weight193.06 g/mol
Exact Mass193.13
IUPAC Nameaminooxy-(2,4-diethylphenyl)borinic acid
SMILESCCc1ccc(B(O)ON)c(CC)c1
InChIInChI=1S/C10H16BNO2/c1-3-8-5-6-10(11(13)14-12)9(4-2)7-8/h5-7,13H,3-4,12H2,1-2H3
InChIKeyOGMRCCRPIQTXET-UHFFFAOYSA-N
XLogP0.39
TPSA55.48 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500193.06
LogP ≤ 50.39
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze aminooxy-(2,4-diethylphenyl)borinic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of aminooxy-(2,4-diethylphenyl)borinic acid?
The IUPAC name of aminooxy-(2,4-diethylphenyl)borinic acid (CID 68784398) is aminooxy-(2,4-diethylphenyl)borinic acid.
What is the SMILES notation for aminooxy-(2,4-diethylphenyl)borinic acid?
The canonical SMILES for aminooxy-(2,4-diethylphenyl)borinic acid is CCc1ccc(B(O)ON)c(CC)c1.
What is the InChIKey of aminooxy-(2,4-diethylphenyl)borinic acid?
The InChIKey is OGMRCCRPIQTXET-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16BNO2/c1-3-8-5-6-10(11(13)14-12)9(4-2)7-8/h5-7,13H,3-4,12H2,1-2H3.
What are the key properties of aminooxy-(2,4-diethylphenyl)borinic acid?
aminooxy-(2,4-diethylphenyl)borinic acid has a molecular weight of 193.06 g/mol, XLogP of 0.39, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for aminooxy-(2,4-diethylphenyl)borinic acid is sourced from PubChem (CID 68784398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).