C10H16BNO2 — CID 68784398
aminooxy-(2,4-diethylphenyl)borinic acid (PubChem CID 68784398) has the molecular formula C10H16BNO2 and a molecular weight of 193.06 g/mol. Its IUPAC name is aminooxy-(2,4-diethylphenyl)borinic acid.
| Compound Name | aminooxy-(2,4-diethylphenyl)borinic acid |
|---|---|
| PubChem CID | 68784398 |
| Molecular Formula | C10H16BNO2 |
| Molecular Weight | 193.06 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | aminooxy-(2,4-diethylphenyl)borinic acid |
| SMILES | CCc1ccc(B(O)ON)c(CC)c1 |
| InChI | InChI=1S/C10H16BNO2/c1-3-8-5-6-10(11(13)14-12)9(4-2)7-8/h5-7,13H,3-4,12H2,1-2H3 |
| InChIKey | OGMRCCRPIQTXET-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.06 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|