C26H27Br2F6NO8S — CID 175955988
2-O-benzyl 1-O-tert-butyl (2R,4R)-4-[(4,5-dibromothiophen-2-yl)methyl]pyrrolidine-1,2-dicarboxylate;bis(2,2,2-trifluoroacetic acid) (PubChem CID 175955988) has the molecular formula C26H27Br2F6NO8S and a molecular weight of 787.36 g/mol. Its IUPAC name is 2-O-benzyl 1-O-tert-butyl (2R,4R)-4-[(4,5-dibromothiophen-2-yl)methyl]pyrrolidine-1,2-dicarboxylate;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 2-O-benzyl 1-O-tert-butyl (2R,4R)-4-[(4,5-dibromothiophen-2-yl)methyl]pyrrolidine-1,2-dicarboxylate;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 175955988 |
| Molecular Formula | C26H27Br2F6NO8S |
| Molecular Weight | 787.36 g/mol |
| Exact Mass | 784.97 |
| IUPAC Name | 2-O-benzyl 1-O-tert-butyl (2R,4R)-4-[(4,5-dibromothiophen-2-yl)methyl]pyrrolidine-1,2-dicarboxylate;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](Cc2cc(Br)c(Br)s2)C[C@@H]1C(=O)OCc1ccccc1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H25Br2NO4S.2C2HF3O2/c1-22(2,3)29-21(27)25-12-15(9-16-11-17(23)19(24)30-16)10-18(25)20(26)28-13-14-7-5-4-6-8-14;2*3-2(4,5)1(6)7/h4-8,11,15,18H,9-10,12-13H2,1-3H3;2*(H,6,7)/t15-,18+;;/m0../s1 |
| InChIKey | YWLTXXRDPWUFGD-AOTNPOKMSA-N |
| XLogP | 7.45 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.36 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |