C20H16N6 — CID 175956132
1-[2-amino-3-[2-(4-aminophenyl)ethynyl]-4-pyridinyl]indazol-3-amine (PubChem CID 175956132) has the molecular formula C20H16N6 and a molecular weight of 340.39 g/mol. Its IUPAC name is 1-[2-amino-3-[2-(4-aminophenyl)ethynyl]-4-pyridinyl]indazol-3-amine.
| Compound Name | 1-[2-amino-3-[2-(4-aminophenyl)ethynyl]-4-pyridinyl]indazol-3-amine |
|---|---|
| PubChem CID | 175956132 |
| Molecular Formula | C20H16N6 |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 1-[2-amino-3-[2-(4-aminophenyl)ethynyl]-4-pyridinyl]indazol-3-amine |
| SMILES | Nc1ccc(C#Cc2c(-n3nc(N)c4ccccc43)ccnc2N)cc1 |
| InChI | InChI=1S/C20H16N6/c21-14-8-5-13(6-9-14)7-10-16-18(11-12-24-19(16)22)26-17-4-2-1-3-15(17)20(23)25-26/h1-6,8-9,11-12H,21H2,(H2,22,24)(H2,23,25) |
| InChIKey | WIORJOHMOVSOOM-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 108.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|