C10H13N3S — CID 170308354
1-(1-methylsulfanylethyl)pyrrolo[3,2-c]pyridin-4-amine (PubChem CID 170308354) has the molecular formula C10H13N3S and a molecular weight of 207.30 g/mol. Its IUPAC name is 1-(1-methylsulfanylethyl)pyrrolo[3,2-c]pyridin-4-amine.
| Compound Name | 1-(1-methylsulfanylethyl)pyrrolo[3,2-c]pyridin-4-amine |
|---|---|
| PubChem CID | 170308354 |
| Molecular Formula | C10H13N3S |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | 1-(1-methylsulfanylethyl)pyrrolo[3,2-c]pyridin-4-amine |
| SMILES | CSC(C)n1ccc2c(N)nccc21 |
| InChI | InChI=1S/C10H13N3S/c1-7(14-2)13-6-4-8-9(13)3-5-12-10(8)11/h3-7H,1-2H3,(H2,11,12) |
| InChIKey | RGPOFPFJPPZXGO-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |