C9H11N3S — CID 146228308
1-(1-methylsulfanylethyl)imidazo[4,5-c]pyridine (PubChem CID 146228308) has the molecular formula C9H11N3S and a molecular weight of 193.27 g/mol. Its IUPAC name is 1-(1-methylsulfanylethyl)imidazo[4,5-c]pyridine.
| Compound Name | 1-(1-methylsulfanylethyl)imidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 146228308 |
| Molecular Formula | C9H11N3S |
| Molecular Weight | 193.27 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 1-(1-methylsulfanylethyl)imidazo[4,5-c]pyridine |
| SMILES | CSC(C)n1cnc2cnccc21 |
| InChI | InChI=1S/C9H11N3S/c1-7(13-2)12-6-11-8-5-10-4-3-9(8)12/h3-7H,1-2H3 |
| InChIKey | ZKKAMVUHLRXFKV-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.27 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |