C17H24LiN4O4 — CID 175963719
CID 175963719 (PubChem CID 175963719) has the molecular formula C17H24LiN4O4 and a molecular weight of 355.34 g/mol.
| Compound Name | CID 175963719 |
|---|---|
| PubChem CID | 175963719 |
| Molecular Formula | C17H24LiN4O4 |
| Molecular Weight | 355.34 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | — |
| SMILES | CC(C)(C)OC(=O)N(C1CC1)[C@@H]1CCN(c2cnc(C(=O)O)cn2)C1.[Li] |
| InChI | InChI=1S/C17H24N4O4.Li/c1-17(2,3)25-16(24)21(11-4-5-11)12-6-7-20(10-12)14-9-18-13(8-19-14)15(22)23;/h8-9,11-12H,4-7,10H2,1-3H3,(H,22,23);/t12-;/m1./s1 |
| InChIKey | ASHDBHNTOVAINI-UTONKHPSSA-N |
| XLogP | 1.77 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.34 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |