C22H34BrN3O2 — CID 118263665
tert-butyl N-[1-(3-bromo-5-methyl-2-pyridinyl)piperidin-4-yl]-N-cyclohexylcarbamate (PubChem CID 118263665) has the molecular formula C22H34BrN3O2 and a molecular weight of 452.44 g/mol. Its IUPAC name is tert-butyl N-[1-(3-bromo-5-methyl-2-pyridinyl)piperidin-4-yl]-N-cyclohexylcarbamate.
| Compound Name | tert-butyl N-[1-(3-bromo-5-methyl-2-pyridinyl)piperidin-4-yl]-N-cyclohexylcarbamate |
|---|---|
| PubChem CID | 118263665 |
| Molecular Formula | C22H34BrN3O2 |
| Molecular Weight | 452.44 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | tert-butyl N-[1-(3-bromo-5-methyl-2-pyridinyl)piperidin-4-yl]-N-cyclohexylcarbamate |
| SMILES | Cc1cnc(N2CCC(N(C(=O)OC(C)(C)C)C3CCCCC3)CC2)c(Br)c1 |
| InChI | InChI=1S/C22H34BrN3O2/c1-16-14-19(23)20(24-15-16)25-12-10-18(11-13-25)26(17-8-6-5-7-9-17)21(27)28-22(2,3)4/h14-15,17-18H,5-13H2,1-4H3 |
| InChIKey | RWOBAJIITFCTIT-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.44 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |