C17H23LiN4O3 — CID 175506318
lithium tert-butyl N-cyclopropyl-N-[(3R)-1-[5-(oxomethyl)pyrazin-2-yl]pyrrolidin-3-yl]carbamate (PubChem CID 175506318) has the molecular formula C17H23LiN4O3 and a molecular weight of 338.34 g/mol. Its IUPAC name is lithium tert-butyl N-cyclopropyl-N-[(3R)-1-[5-(oxomethyl)pyrazin-2-yl]pyrrolidin-3-yl]carbamate.
| Compound Name | lithium tert-butyl N-cyclopropyl-N-[(3R)-1-[5-(oxomethyl)pyrazin-2-yl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 175506318 |
| Molecular Formula | C17H23LiN4O3 |
| Molecular Weight | 338.34 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | lithium tert-butyl N-cyclopropyl-N-[(3R)-1-[5-(oxomethyl)pyrazin-2-yl]pyrrolidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(C1CC1)[C@@H]1CCN(c2cnc([C-]=O)cn2)C1.[Li+] |
| InChI | InChI=1S/C17H23N4O3.Li/c1-17(2,3)24-16(23)21(13-4-5-13)14-6-7-20(10-14)15-9-18-12(11-22)8-19-15;/h8-9,13-14H,4-7,10H2,1-3H3;/q-1;+1/t14-;/m1./s1 |
| InChIKey | AHDSQKYRLDBORT-PFEQFJNWSA-N |
| XLogP | -1.08 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.34 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|