C16H16N2O — CID 175965401
3-(cyclopropylmethoxy)-1-methyl-9H-pyrido[3,4-b]indole (PubChem CID 175965401) has the molecular formula C16H16N2O and a molecular weight of 252.32 g/mol. Its IUPAC name is 3-(cyclopropylmethoxy)-1-methyl-9H-pyrido[3,4-b]indole.
| Compound Name | 3-(cyclopropylmethoxy)-1-methyl-9H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 175965401 |
| Molecular Formula | C16H16N2O |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 3-(cyclopropylmethoxy)-1-methyl-9H-pyrido[3,4-b]indole |
| SMILES | Cc1nc(OCC2CC2)cc2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C16H16N2O/c1-10-16-13(12-4-2-3-5-14(12)18-16)8-15(17-10)19-9-11-6-7-11/h2-5,8,11,18H,6-7,9H2,1H3 |
| InChIKey | KXFLOITYJNKJTJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |